| název výrobku |
N-dodecyl-β-alanine, compound with 2,2',2''-nitrilotriethanol (1:1) |
| Synonyma |
beta-Alanine, N-dodecyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1); TEA-Lauraminopropionate; TEA-N-Lauryl, myristyl beta-aminopropionate; Triethanolamine lauryl aminopropionate; N-Lauryl-beta-aminopropionic acid, triethanolamine salt; N-Dodecyl-beta-alanine, compound with 2,2',2''-nitrilotriethanol (1:1); N-dodecyl-beta-alanine - 2,2',2''-nitrilotriethanol (1:1) |
| Molekulární vzorec |
C21H46N2O5 |
| Molekulová hmotnost |
406.6003 |
| InChI |
InChI=1/C15H31NO2.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-13-16-14-12-15(17)18;8-4-1-7(2-5-9)3-6-10/h16H,2-14H2,1H3,(H,17,18);8-10H,1-6H2 |
| Registrační číslo CAS |
14171-00-7 |
| EINECS |
238-015-1 |
| Molekulární struktura |
|
| Bod varu |
379.1°C at 760 mmHg |
| Bod vzplanutí |
183.1°C |
|
