| Produkt-Name |
5-(2,6-dichloro-4-pyridyl)-1,3,4-oxadiazole-2-thiol |
| Synonyme |
5-(2,6-dichloropyridin-4-yl)-1,3,4-oxadiazole-2(3H)-thione |
| Molekulare Formel |
C7H3Cl2N3OS |
| Molecular Weight |
248.0892 |
| InChI |
InChI=1/C7H3Cl2N3OS/c8-4-1-3(2-5(9)10-4)6-11-12-7(14)13-6/h1-2H,(H,12,14) |
| CAS Registry Number |
119221-62-4 |
| Molecular Structure |
|
| Dichte |
1.82g/cm3 |
| Schmelzpunkt |
205℃ |
| Siedepunkt |
358.9°C at 760 mmHg |
| Brechungsindex |
1.773 |
| Flammpunkt |
170.9°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
