Produkt-Name |
2,6-Dichloronitrosobenzene |
Synonyme |
1,3-dichloro-2-nitrosobenzene |
Molekulare Formel |
C6H3Cl2NO |
Molecular Weight |
176.0001 |
InChI |
InChI=1/C6H3Cl2NO/c7-4-2-1-3-5(8)6(4)9-10/h1-3H |
CAS Registry Number |
1194-66-7 |
Molecular Structure |
|
Dichte |
1.45g/cm3 |
Siedepunkt |
271.9°C at 760 mmHg |
Brechungsindex |
1.588 |
Flammpunkt |
120.5°C |
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|