| Produkt-Name |
3,5-difluorobenzamide |
| Synonyme |
Difluorobenzamide6 |
| Molekulare Formel |
C7H5F2NO |
| Molecular Weight |
157.1175 |
| InChI |
InChI=1/C7H5F2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
| CAS Registry Number |
132980-99-5 |
| Molecular Structure |
|
| Dichte |
1.348g/cm3 |
| Schmelzpunkt |
155-157℃ |
| Siedepunkt |
187.7°C at 760 mmHg |
| Brechungsindex |
1.515 |
| Flammpunkt |
67.3°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
