Produkt-Name |
5-(4-Nitrophenyl)-1H-tetrazole |
Synonyme |
5-(4-Nitrophenyl)tetrazole; 5-(4-nitrophenyl)-2H-tetrazole |
Molekulare Formel |
C7H5N5O2 |
Molecular Weight |
191.1469 |
InChI |
InChI=1/C7H5N5O2/c13-12(14)6-3-1-5(2-4-6)7-8-10-11-9-7/h1-4H,(H,8,9,10,11) |
CAS Registry Number |
16687-60-8 |
Molecular Structure |
|
Dichte |
1.534g/cm3 |
Siedepunkt |
435.3°C at 760 mmHg |
Brechungsindex |
1.662 |
Flammpunkt |
217.1°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|