Produkt-Name |
2,5-Dichlorotoluene |
Synonyme |
Benzene, 1,4-dichloro-2-methyl-; NSC 86117; Toluene, 2,5-dichloro- (8CI); 1,4-dichloro-2-methylbenzene |
Molekulare Formel |
C7H6Cl2 |
Molecular Weight |
161.0285 |
InChI |
InChI=1/C7H6Cl2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
CAS Registry Number |
19398-61-9 |
EINECS |
243-032-2 |
Molecular Structure |
|
Dichte |
1.242g/cm3 |
Schmelzpunkt |
4-5℃ |
Siedepunkt |
197.4°C at 760 mmHg |
Brechungsindex |
1.543 |
Flammpunkt |
79.4°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|