Produkt-Name |
phenyl(4-pyridyl)methanol |
Synonyme |
alpha-Phenylpyridine-4-methanol; phenyl(pyridin-4-yl)methanol |
Molekulare Formel |
C12H11NO |
Molecular Weight |
185.2218 |
InChI |
InChI=1/C12H11NO/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-9,12,14H |
CAS Registry Number |
33974-27-5 |
EINECS |
251-770-1 |
Molecular Structure |
|
Dichte |
1.155g/cm3 |
Schmelzpunkt |
120℃ |
Siedepunkt |
353.5°C at 760 mmHg |
Brechungsindex |
1.604 |
Flammpunkt |
167.6°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|