Produkt-Name |
N,N-Bis(2-cyanoethyl)formamide |
Synonyme |
3,3-(Formylimino)dipropionitrile; NN-Bis(2-cyanoethyl)formamide, Pract. |
Molekulare Formel |
C7H9N3O |
Molecular Weight |
151.1659 |
InChI |
InChI=1/C7H9N3O/c8-3-1-5-10(7-11)6-2-4-9/h7H,1-2,5-6H2 |
CAS Registry Number |
3445-84-9 |
EINECS |
222-362-0 |
Molecular Structure |
|
Dichte |
1.116g/cm3 |
Siedepunkt |
444.1°C at 760 mmHg |
Brechungsindex |
1.476 |
Flammpunkt |
222.4°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|