Produkt-Name |
2-Phenyl-2-pentenal |
Synonyme |
Benzeneacetaldehyde, alpha-propylidene-; (2E)-2-phenylpent-2-enal |
Molekulare Formel |
C11H12O |
Molecular Weight |
160.2124 |
InChI |
InChI=1/C11H12O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h3-9H,2H2,1H3/b11-6- |
CAS Registry Number |
3491-63-2 |
Molecular Structure |
|
Dichte |
0.976g/cm3 |
Siedepunkt |
286.7°C at 760 mmHg |
Brechungsindex |
1.524 |
Flammpunkt |
106.2°C |
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|