| Produkt-Name |
2-Amino-4-cyanopyridine |
| Synonyme |
2-Aminoisonicotinonitrile; 4-Cyano-2-pyridinamine; 2-aminopyridine-4-carbonitrile |
| Molekulare Formel |
C6H5N3 |
| Molecular Weight |
119.124 |
| InChI |
InChI=1/C6H5N3/c7-4-5-1-2-9-6(8)3-5/h1-3H,(H2,8,9) |
| CAS Registry Number |
42182-27-4 |
| Molecular Structure |
|
| Dichte |
1.23g/cm3 |
| Siedepunkt |
297.7°C at 760 mmHg |
| Brechungsindex |
1.594 |
| Flammpunkt |
133.8°C |
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
