Produkt-Name |
4-Ethylbiphenyl |
Synonyme |
1,1'-Biphenyl, 4-ethyl- (9CI); 1-Ethyl-4-phenylbenzene; NSC 60063; p-Ethylbiphenyl; 1,1'-Biphenyl, 4-ethyl-; Biphenyl, 4-ethyl- (8CI); 2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-oxoethyl biphenyl-4-ylacetate |
Molekulare Formel |
C30H27NO5 |
Molecular Weight |
481.5391 |
InChI |
InChI=1/C30H27NO5/c1-20-14-26(21(2)31(20)17-23-10-13-28-29(15-23)36-19-35-28)27(32)18-34-30(33)16-22-8-11-25(12-9-22)24-6-4-3-5-7-24/h3-15H,16-19H2,1-2H3 |
CAS Registry Number |
5707-44-8 |
Molecular Structure |
|
Dichte |
1.21g/cm3 |
Schmelzpunkt |
34-35.5℃ |
Siedepunkt |
655.8°C at 760 mmHg |
Brechungsindex |
1.612 |
Flammpunkt |
350.4°C |
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|