Produkt-Name |
2-Iodo-m-xylene |
Synonyme |
2-Iodo-1,3-Dimethylbenzene |
Molekulare Formel |
C8H9I |
Molecular Weight |
232.0615 |
InChI |
InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
CAS Registry Number |
608-28-6 |
EINECS |
210-158-4 |
Molecular Structure |
|
Dichte |
1.61g/cm3 |
Siedepunkt |
227.5°C at 760 mmHg |
Brechungsindex |
1.592 |
Flammpunkt |
98.1°C |
Wasserlöslichkeit |
insoluble |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection;
|
|