Produkt-Name |
2-Amino-4-methylamino-6-ethoxy-1,3,5-triazine |
Molekulare Formel |
C6H11N5O |
Molecular Weight |
169.1844 |
InChI |
InChI=1/C6H11N5O/c1-3-12-6-10-4(7)9-5(8-2)11-6/h3H2,1-2H3,(H3,7,8,9,10,11) |
CAS Registry Number |
62096-63-3 |
Molecular Structure |
|
Dichte |
1.288g/cm3 |
Schmelzpunkt |
171-174℃ |
Siedepunkt |
365.9°C at 760 mmHg |
Brechungsindex |
1.612 |
Flammpunkt |
175.1°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|