Produkt-Name |
5-methyl-2-thiouracil |
Synonyme |
4-Hydroxy-2-mercapto-5-methylpyrimidine; 2-Thiothymine; 5-methyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
Molekulare Formel |
C5H6N2OS |
Molecular Weight |
142.1789 |
InChI |
InChI=1/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
CAS Registry Number |
636-26-0 |
Molecular Structure |
|
Dichte |
1.36g/cm3 |
Schmelzpunkt |
265-267℃ |
Siedepunkt |
329.7°C at 760 mmHg |
Brechungsindex |
1.638 |
Flammpunkt |
153.2°C |
Risk Codes |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|