| Produkt-Name |
1,2-Epoxy-5-cyclooctene |
| Synonyme |
9-oxabicyclo(6.1.0)non-4-ene; 9-Oxabicyclo[6.1.0]non-4-ene; (4Z)-9-oxabicyclo[6.1.0]non-4-ene; (1S,4Z,8S)-9-oxabicyclo[6.1.0]non-4-ene |
| Molekulare Formel |
C8H12O |
| Molecular Weight |
124.1803 |
| InChI |
InChI=1/C8H12O/c1-2-4-6-8-7(9-8)5-3-1/h1-2,7-8H,3-6H2/b2-1-/t7-,8-/m0/s1 |
| CAS Registry Number |
637-90-1 |
| EINECS |
211-308-1 |
| Molecular Structure |
|
| Dichte |
0.993g/cm3 |
| Siedepunkt |
178.1°C at 760 mmHg |
| Brechungsindex |
1.49 |
| Flammpunkt |
54.3°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
