Produkt-Name |
6-Methyl-1,2,3,4-tetrahydroquinoline |
Synonyme |
1,2,3,4-Tetrahydro-6-methylquinoline; AI3-36188; Civettal; NSC 65606; p-Methyltetrahydroquinoline; Quinoline, 1,2,3,4-tetrahydro-6-methyl- |
Molekulare Formel |
C10H13N |
Molecular Weight |
147.2169 |
InChI |
InChI=1/C10H13N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h4-5,7,11H,2-3,6H2,1H3 |
CAS Registry Number |
91-61-2 |
EINECS |
202-083-0 |
Molecular Structure |
|
Dichte |
0.99g/cm3 |
Siedepunkt |
264.2°C at 760 mmHg |
Brechungsindex |
1.539 |
Flammpunkt |
119.1°C |
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|