| Produkt-Name |
2-Amino-3,5-dibromo-6-methylpyridine |
| Synonyme |
3,5-Dibromo-6-methylpyridin-2-amine; 2-amino-3,5-dibromo-6-methylpyridinium |
| Molekulare Formel |
C6H7Br2N2 |
| Molecular Weight |
266.9406 |
| InChI |
InChI=1/C6H6Br2N2/c1-3-4(7)2-5(8)6(9)10-3/h2H,1H3,(H2,9,10)/p+1 |
| CAS Registry Number |
91872-10-5 |
| Molecular Structure |
|
| Schmelzpunkt |
144℃ |
| Siedepunkt |
261.6°C at 760 mmHg |
| Flammpunkt |
112°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
