product Name |
2,6-Dimethylanisole |
Synonyms |
1,3-Dimethyl-2-methoxybenzene; 2,6-Dimethylanisone; 2-Methoxy-m-xylene; 2-methoxy-1,3-dimethyl-benzene |
Molecular Formula |
C9H12O |
Molecular Weight |
136.191 |
InChI |
InChI=1/C9H12O/c1-7-5-4-6-8(2)9(7)10-3/h4-6H,1-3H3 |
CAS Registry Number |
1004-66-6 |
EINECS |
213-723-3 |
Molecular Structure |
|
Density |
0.932g/cm3 |
Boiling point |
181°C at 760 mmHg |
Refractive index |
1.495 |
Flash point |
67.2°C |
Vapour Pressur |
1.18mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|