| product Name |
2-Phenylmalonamide |
| Synonyms |
2-Phenylmalondiamide; 2-phenylpropanediamide |
| Molecular Formula |
C9H10N2O2 |
| Molecular Weight |
178.1879 |
| InChI |
InChI=1/C9H10N2O2/c10-8(12)7(9(11)13)6-4-2-1-3-5-6/h1-5,7H,(H2,10,12)(H2,11,13) |
| CAS Registry Number |
10255-95-5 |
| Molecular Structure |
|
| Density |
1.262g/cm3 |
| Boiling point |
437.3°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
218.3°C |
| Vapour Pressur |
7.54E-08mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
