product Name |
Anisoin |
Synonyms |
4,4-Dimethoxybenzoin; 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone; (2S)-2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone; (2R)-2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone |
Molecular Formula |
C16H16O4 |
Molecular Weight |
272.2958 |
InChI |
InChI=1/C16H16O4/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10,15,17H,1-2H3/t15-/m1/s1 |
CAS Registry Number |
119-52-8 |
EINECS |
204-330-8 |
Molecular Structure |
|
Density |
1.194g/cm3 |
Melting point |
109-114℃ |
Boiling point |
459.4°C at 760 mmHg |
Refractive index |
1.578 |
Flash point |
171°C |
Vapour Pressur |
3.11E-09mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|