product Name |
2,4,6-Trimethoxynitrobenzene |
Synonyms |
2,4,6-Trimethoxybitrobenzene; 2-Nitro-1,3,5-trimethoxybenzene~2,4,6-Trimethoxynitrobenzene; 1,3,5-trimethoxy-2-nitrobenzene; 1,2,4-trimethoxy-5-nitrobenzene |
Molecular Formula |
C9H11NO5 |
Molecular Weight |
213.1873 |
InChI |
InChI=1/C9H11NO5/c1-13-7-5-9(15-3)8(14-2)4-6(7)10(11)12/h4-5H,1-3H3 |
CAS Registry Number |
14227-18-0 |
Molecular Structure |
|
Density |
1.23g/cm3 |
Melting point |
151-151℃ |
Boiling point |
357.3°C at 760 mmHg |
Refractive index |
1.521 |
Flash point |
169.9°C |
Vapour Pressur |
5.67E-05mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|