product Name |
3-Aminothiophene-2-carboxamide |
Molecular Formula |
C5H6N2OS |
Molecular Weight |
142.1789 |
InChI |
InChI=1/C5H6N2OS/c6-3-1-2-9-4(3)5(7)8/h1-2H,6H2,(H2,7,8) |
CAS Registry Number |
147123-47-5 |
Molecular Structure |
|
Density |
1.423g/cm3 |
Melting point |
120℃ |
Boiling point |
368.7°C at 760 mmHg |
Refractive index |
1.681 |
Flash point |
176.8°C |
Vapour Pressur |
1.25E-05mmHg at 25°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|