product Name |
L-1,4-Dithiothreitol |
Synonyms |
(+/-)-1,4-Dimercapto-2,3-butanediol; (2R*,3S*)-1,4-dimercapto-2,3-butanediol; (2R*,3S*)-1,4-dimercaptobutane-2,3-diol; (R*,R*)-1,4-DIMERCAPTO-2,3-BUTANEDIOL; 1,4-Bissulfanylbutane-2,3-diol; 1,4-Disulfanylbutane-2,3-diol; 16096-97-2; 2,3-Butanediol, 1,4-dimercapto-, (R*,R*)-; 2,3-Butanediol, 1,4-dimercapto-, (R*,S*)-; (2R,3R)-1,4-disulfanylbutane-2,3-diol |
Molecular Formula |
C4H10O2S2 |
Molecular Weight |
154.251 |
InChI |
InChI=1/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2/t3-,4-/m0/s1 |
CAS Registry Number |
16096-97-2 |
EINECS |
240-263-0 |
Molecular Structure |
|
Density |
1.302g/cm3 |
Melting point |
50-54℃ |
Boiling point |
364.5°C at 760 mmHg |
Refractive index |
1.579 |
Flash point |
174.2°C |
Vapour Pressur |
8.68E-07mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|