| product Name |
4-Chloro-3-nitro-2-pyridone |
| Synonyms |
4-Chloro-2-hydroxy-3-nitropyridine; 4-chloro-3-nitropyridin-2(1H)-one; 4-Chloro-3-Nitropyridin-2-Ol |
| Molecular Formula |
C5H3ClN2O3 |
| Molecular Weight |
174.5419 |
| InChI |
InChI=1/C5H3ClN2O3/c6-3-1-2-7-5(9)4(3)8(10)11/h1-2H,(H,7,9) |
| CAS Registry Number |
165547-79-5 |
| Molecular Structure |
|
| Density |
1.61g/cm3 |
| Boiling point |
283.4°C at 760 mmHg |
| Refractive index |
1.602 |
| Flash point |
125.2°C |
| Vapour Pressur |
0.00316mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
