product Name |
2-Acetyl-1-tetralone |
Synonyms |
2-acetyl-1,2,3,4-tetrahydronaphthalen-1-one; 2-acetyl-3,4-dihydronaphthalen-1(2H)-one; 1-(1-hydroxy-3,4-dihydronaphthalen-2-yl)ethanone |
Molecular Formula |
C12H12O2 |
Molecular Weight |
188.2225 |
InChI |
InChI=1/C12H12O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-5,14H,6-7H2,1H3 |
CAS Registry Number |
17216-08-9 |
EINECS |
241-259-1 |
Molecular Structure |
|
Density |
1.223g/cm3 |
Melting point |
55-57℃ |
Boiling point |
359.4°C at 760 mmHg |
Refractive index |
1.611 |
Flash point |
153.3°C |
Vapour Pressur |
8.59E-06mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|