product Name |
1-Acetyl-5-bromoindoline |
Synonyms |
1-acetyl-5-bromoindoline crystalline; 1-(5-Bromo-2,3-dihydro-1H-indol-1-yl)ethan-1-one; 1-Acetyl-5-bromo-1H-indole; 1-(5-bromo-2,3-dihydro-1H-indol-1-yl)ethanone |
Molecular Formula |
C10H10BrNO |
Molecular Weight |
240.0965 |
InChI |
InChI=1/C10H10BrNO/c1-7(13)12-5-4-8-6-9(11)2-3-10(8)12/h2-3,6H,4-5H2,1H3 |
CAS Registry Number |
22190-38-1 |
Molecular Structure |
|
Density |
1.529g/cm3 |
Melting point |
119-122℃ |
Boiling point |
423.6°C at 760 mmHg |
Refractive index |
1.607 |
Flash point |
210°C |
Vapour Pressur |
2.2E-07mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|