product Name |
5-Chloromethyl-2-oxazolidinone |
Synonyms |
5-Chloromethyloxazolidin-2-one; 5-(chloromethyl)-1,3-oxazolidin-2-one; (5R)-5-(chloromethyl)-1,3-oxazolidin-2-one; (5S)-5-(chloromethyl)-1,3-oxazolidin-2-one |
Molecular Formula |
C4H6ClNO2 |
Molecular Weight |
135.5489 |
InChI |
InChI=1/C4H6ClNO2/c5-1-3-2-6-4(7)8-3/h3H,1-2H2,(H,6,7)/t3-/m1/s1 |
CAS Registry Number |
22625-57-6 |
EINECS |
245-137-9 |
Molecular Structure |
|
Density |
1.294g/cm3 |
Melting point |
101-105℃ |
Boiling point |
382.8°C at 760 mmHg |
Refractive index |
1.455 |
Flash point |
185.3°C |
Vapour Pressur |
4.6E-06mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|