product Name |
Nalpha-Carbobenzyloxy-L-asparagine |
Synonyms |
N-Benzyloxycarbonyl-L-asparagine; Z-Asn-OH; Cbz-L-asparagine; Cbz-Asn-OH |
Molecular Formula |
C12H14N2O5 |
Molecular Weight |
266.25 |
InChI |
InChI=1/C12H14N2O5/c13-10(15)6-9(11(16)17)14-12(18)19-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,13,15)(H,14,18)(H,16,17)/t9-/m1/s1 |
CAS Registry Number |
2304-96-3 |
EINECS |
218-969-5 |
Molecular Structure |
|
Density |
1.355g/cm3 |
Melting point |
160-165℃ |
Boiling point |
580.6°C at 760 mmHg |
Refractive index |
1.573 |
Flash point |
304.9°C |
Vapour Pressur |
2.54E-14mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|