| product Name |
3-Bromo-2,4,5,6-tetrafluorobenzoylchloride |
| Synonyms |
3-Bromo-2,4,5,6-tetrafluorobenzoyl chloride |
| Molecular Formula |
C7BrClF4O |
| Molecular Weight |
291.4249 |
| InChI |
InChI=1/C7BrClF4O/c8-2-3(10)1(7(9)14)4(11)6(13)5(2)12 |
| CAS Registry Number |
292621-46-6 |
| Molecular Structure |
|
| Density |
1.957g/cm3 |
| Boiling point |
206.8°C at 760 mmHg |
| Refractive index |
1.505 |
| Flash point |
78.9°C |
| Vapour Pressur |
0.233mmHg at 25°C |
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
