product Name |
4-Nitrocatechol |
Synonyms |
4-nitropyrocatechol; 3,4-Dihydroxynitrobenzene; 2-hydroxy-4-nitrophenolate; 4-nitrobenzene-1,2-diol |
Molecular Formula |
C6H5NO4 |
Molecular Weight |
155.1082 |
InChI |
InChI=1/C6H5NO4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H |
CAS Registry Number |
3316-09-4 |
EINECS |
222-009-0 |
Molecular Structure |
|
Density |
1.58g/cm3 |
Melting point |
173-177℃ |
Boiling point |
358.2°C at 760 mmHg |
Refractive index |
1.667 |
Flash point |
168.8°C |
Vapour Pressur |
1.25E-05mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|