product Name |
2-Amino-3-benzyl-5-(4-methoxyphenyl)pyrazine |
Synonyms |
3-benzyl-5-(4-methoxyphenyl)pyrazin-2-amine |
Molecular Formula |
C18H17N3O |
Molecular Weight |
291.3471 |
InChI |
InChI=1/C18H17N3O/c1-22-15-9-7-14(8-10-15)17-12-20-18(19)16(21-17)11-13-5-3-2-4-6-13/h2-10,12H,11H2,1H3,(H2,19,20) |
CAS Registry Number |
40040-81-1 |
Molecular Structure |
|
Density |
1.18g/cm3 |
Boiling point |
461.4°C at 760 mmHg |
Refractive index |
1.624 |
Flash point |
232.8°C |
Vapour Pressur |
1.08E-08mmHg at 25°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|