product Name |
4-Amino-2,6-dimethylpyrimidine |
Synonyms |
Kyanmethin; 2,6-dimethylpyrimidin-4-ylamine; 2,6-dimethylpyrimidin-4-amine |
Molecular Formula |
C6H9N3 |
Molecular Weight |
123.1558 |
InChI |
InChI=1/C6H9N3/c1-4-3-6(7)9-5(2)8-4/h3H,1-2H3,(H2,7,8,9) |
CAS Registry Number |
461-98-3 |
EINECS |
207-320-1 |
Molecular Structure |
|
Density |
1.112g/cm3 |
Melting point |
182-185℃ |
Boiling point |
238.7°C at 760 mmHg |
Refractive index |
1.569 |
Flash point |
121.3°C |
Vapour Pressur |
0.0417mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|