product Name |
4-ethoxybenzamide |
Synonyms |
p-Ethoxybenzamide; 4-ethoxy benzamide |
Molecular Formula |
C9H11NO2 |
Molecular Weight |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3,(H2,10,11) |
CAS Registry Number |
55836-71-0 |
EINECS |
259-847-1 |
Molecular Structure |
|
Density |
1.111g/cm3 |
Melting point |
208-210℃ |
Boiling point |
307.7°C at 760 mmHg |
Refractive index |
1.538 |
Flash point |
159°C |
Vapour Pressur |
0.000714mmHg at 25°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|