product Name |
2-Bromo-4-methylacetanilide |
Synonyms |
2-Bromo-4-methylactanilide; N-(2-bromo-4-methylphenyl)acetamide |
Molecular Formula |
C9H10BrNO |
Molecular Weight |
228.0858 |
InChI |
InChI=1/C9H10BrNO/c1-6-3-4-9(8(10)5-6)11-7(2)12/h3-5H,1-2H3,(H,11,12) |
CAS Registry Number |
614-83-5 |
Molecular Structure |
|
Density |
1.471g/cm3 |
Melting point |
117-119℃ |
Boiling point |
349.9°C at 760 mmHg |
Refractive index |
1.6 |
Flash point |
165.4°C |
Vapour Pressur |
4.57E-05mmHg at 25°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|