product Name |
2-Chloro-5-methylphenol |
Synonyms |
4-Chloro-3-hydroxytoluene; 6-chloro-m-cresol |
Molecular Formula |
C7H7ClO |
Molecular Weight |
142.58 |
InChI |
InChI=1/C7H7ClO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
CAS Registry Number |
615-74-7 |
EINECS |
210-444-9 |
Molecular Structure |
|
Density |
1.215 |
Melting point |
45-48℃ |
Boiling point |
196℃ |
Flash point |
81℃ |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R21/22:Harmful in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|