| product Name |
7-Hydroxyflavanone |
| Synonyms |
4H-1-Benzopyran-4-one, 2,3-dihydro-7-hydroxy-2-phenyl-; 7-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2R)-7-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-7-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Molecular Formula |
C15H12O3 |
| Molecular Weight |
240.254 |
| InChI |
InChI=1/C15H12O3/c16-11-6-7-12-13(17)9-14(18-15(12)8-11)10-4-2-1-3-5-10/h1-8,14,16H,9H2/t14-/m0/s1 |
| CAS Registry Number |
6515-36-2 |
| Molecular Structure |
|
| Density |
1.288g/cm3 |
| Melting point |
188-190℃ |
| Boiling point |
464.3°C at 760 mmHg |
| Refractive index |
1.631 |
| Flash point |
181.2°C |
| Vapour Pressur |
3.05E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
