product Name |
4-bromo-1,3-benzodioxole |
Synonyms |
4-bromobenzo[d][1,3]dioxole |
Molecular Formula |
C7H5BrO2 |
Molecular Weight |
201.0174 |
InChI |
InChI=1/C7H5BrO2/c8-5-2-1-3-6-7(5)10-4-9-6/h1-3H,4H2 |
CAS Registry Number |
6698-13-1 |
Molecular Structure |
|
Density |
1.721g/cm3 |
Boiling point |
238.258°C at 760 mmHg |
Refractive index |
1.603 |
Flash point |
109.652°C |
Vapour Pressur |
0.066mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|