product Name |
tri-O-benzyl-D-galactal |
Synonyms |
3,4,6-Tri-O-benzyl-D-galactal; 2,6-anhydro-1,3,4-tri-O-benzyl-5-deoxy-D-arabino-hex-5-enitol |
Molecular Formula |
C27H28O4 |
Molecular Weight |
416.5088 |
InChI |
InChI=1/C27H28O4/c1-4-10-22(11-5-1)18-28-21-26-27(31-20-24-14-8-3-9-15-24)25(16-17-29-26)30-19-23-12-6-2-7-13-23/h1-17,25-27H,18-21H2/t25-,26-,27-/m1/s1 |
CAS Registry Number |
80040-79-5 |
Molecular Structure |
|
Density |
1.16g/cm3 |
Melting point |
48℃ |
Boiling point |
544.9°C at 760 mmHg |
Refractive index |
1.603 |
Flash point |
129.7°C |
Vapour Pressur |
2.24E-11mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|