product Name |
7-Methyladenine |
Synonyms |
6-Amino-7-methylpurine; 7-methyl-7H-purin-6-amine |
Molecular Formula |
C6H7N5 |
Molecular Weight |
149.1533 |
InChI |
InChI=1/C6H7N5/c1-11-3-10-6-4(11)5(7)8-2-9-6/h2-3H,1H3,(H2,7,8,9) |
CAS Registry Number |
935-69-3 |
Molecular Structure |
|
Density |
1.6g/cm3 |
Melting point |
323℃ |
Boiling point |
385.9°C at 760 mmHg |
Refractive index |
1.807 |
Flash point |
187.2°C |
Vapour Pressur |
3.67E-06mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|