| Nombre del producto |
3-(N-ethylanilino)propiononitrile |
| Sinónimos |
N-(2-Cyanoethyl)-N-ethylaniline; 3-(N-Ethylanilino)propionitrile; N-ethyl-N-cyanoethylaniline; 3-[ethyl(phenyl)amino]propanenitrile; 3-Ethylanilinopropiononitrile |
| Fórmula molecular |
C11H14N2 |
| Peso Molecular |
174.2423 |
| InChI |
InChI=1/C11H14N2/c1-2-13(10-6-9-12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,10H2,1H3 |
| Número de registro CAS |
148-87-8 |
| EINECS |
205-728-4 |
| Estructura Molecular |
|
| Densidad |
1.022g/cm3 |
| Punto de ebullición |
311.9°C at 760 mmHg |
| Índice de refracción |
1.551 |
| Punto de inflamación |
132.8°C |
| Descripción de Seguridad |
S24/25:Avoid contact with skin and eyes.;
|
|
