| Nombre del producto |
2-fluoro-6-nitrophenol |
| Sinónimos |
2-nitro-6-fluorophenol; Phenol, 2-fluoro-6-nitro- |
| Fórmula molecular |
C6H4FNO3 |
| Peso Molecular |
157.1 |
| InChI |
InChI=1/C6H4FNO3/c7-4-2-1-3-5(6(4)9)8(10)11/h1-3,9H |
| Número de registro CAS |
1526-17-6 |
| EINECS |
216-199-4 |
| Estructura Molecular |
|
| Códigos de Riesgos |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descripción de Seguridad |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
