| Nombre del producto |
N,N-Dimethylbutyramide |
| Sinónimos |
Butanamide, N,N-dimethyl-; 4-04-00-00185 (Beilstein Handbook Reference); AI3-36713; BRN 1742172; Butyramide, N,N-dimethyl-; N,N-Dimethyl-n-butyramide; N,N-Dimethylbutanamide; NSC 54115 |
| Fórmula molecular |
C6H13NO |
| Peso Molecular |
115.1735 |
| InChI |
InChI=1/C6H13NO/c1-4-5-6(8)7(2)3/h4-5H2,1-3H3 |
| Número de registro CAS |
760-79-2 |
| Estructura Molecular |
|
| Densidad |
0.872g/cm3 |
| Punto de ebullición |
186.5°C at 760 mmHg |
| Índice de refracción |
1.422 |
| Punto de inflamación |
69.3°C |
| Descripción de Seguridad |
S24/25:Avoid contact with skin and eyes.;
|
|
