| Nombre del producto |
iodopentafluorobenzene |
| Sinónimos |
Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene |
| Fórmula molecular |
C6F5I |
| Peso Molecular |
293.9607 |
| InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| Número de registro CAS |
827-15-6 |
| EINECS |
212-565-2 |
| Estructura Molecular |
|
| Densidad |
2.217g/cm3 |
| Punto de ebullición |
166.7°C at 760 mmHg |
| Índice de refracción |
1.502 |
| Punto de inflamación |
61.3°C |
| Códigos de Riesgos |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descripción de Seguridad |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
