| Nom |
3,3-diethoxy-1-propyne |
| Synonymes |
Propiolaldehyde diethyl acetal; Propargylaldehyde diethyl acetal; 3,3-diethoxyprop-1-yne; Propynal diethyl acetal |
| Formule moléculaire |
C7H12O2 |
| Poids Moléculaire |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-4-7(8-5-2)9-6-3/h1,7H,5-6H2,2-3H3 |
| Numéro de registre CAS |
10160-87-9 |
| EINECS |
233-430-4 |
| Structure moléculaire |
|
| Densité |
0.909g/cm3 |
| Point d'ébullition |
139°C at 760 mmHg |
| Indice de réfraction |
1.421 |
| Point d'éclair |
32.2°C |
| Codes des risques |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Description de sécurité |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
