| Nom |
Pentamethylphenylacetonitrile |
| Synonymes |
2,3,4,5,6-Pentamethylbenzyl cyanide |
| Formule moléculaire |
C13H17N |
| Poids Moléculaire |
187.2808 |
| InChI |
InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
| Numéro de registre CAS |
34688-70-5 |
| Structure moléculaire |
|
| Densité |
0.95g/cm3 |
| Point de fusion |
105-107℃ |
| Point d'ébullition |
325.9°C at 760 mmHg |
| Indice de réfraction |
1.519 |
| Point d'éclair |
160.2°C |
| Codes des risques |
R20/22:Harmful by inhalation and if swallowed.;
|
| Description de sécurité |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
