| Nom |
1-Chloro-2,5-diethoxy-4-nitrobenzene |
| Synonymes |
Benzene, 1-chloro-2,5-diethoxy-4-nitro-; 2,5-Diethoxy-4-nitrochlorobenzene; 5-Chloro-2-nitro-p-diethoxybenzene; NSC 60284 |
| Formule moléculaire |
C10H12ClNO4 |
| Poids Moléculaire |
245.6596 |
| InChI |
InChI=1/C10H12ClNO4/c1-3-15-9-6-8(12(13)14)10(16-4-2)5-7(9)11/h5-6H,3-4H2,1-2H3 |
| Numéro de registre CAS |
91-43-0 |
| EINECS |
202-067-3 |
| Structure moléculaire |
|
| Densité |
1.264g/cm3 |
| Point d'ébullition |
368.4°C at 760 mmHg |
| Indice de réfraction |
1.533 |
| Point d'éclair |
176.6°C |
| Les symboles de danger |
 Xi:Irritant;
|
| Codes des risques |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Description de sécurité |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
