Ονομασία του προϊόντος |
2,6-Dichloro-beta-nitrostyrene |
Συνώνυμα |
1-(2,6-Dichlorophenyl)-2-nitroethene; 1,3-dichloro-2-[(E)-2-nitroethenyl]benzene |
MF |
C8H5Cl2NO2 |
Μοριακό βάρος |
218.0368 |
InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H/b5-4+ |
CAS ΟΧΙ |
120355-50-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.447g/cm3 |
Σημείο βρασμού |
330.6°C at 760 mmHg |
Δείκτης διάθλασης |
1.626 |
Σημείο ανάφλεξης |
153.7°C |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|