| Ονομασία του προϊόντος |
2,4-Diamino-s-triazine |
| Συνώνυμα |
Diaminotriazine; 1,3,5-triazine-2,4-diamine; 2,4-Diamino-1,3,5-Triazine |
| MF |
C3H5N5 |
| Μοριακό βάρος |
111.1053 |
| InChI |
InChI=1/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) |
| CAS ΟΧΙ |
504-08-5 |
| EINECS |
207-983-7 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.508g/cm3 |
| Σημείο βρασμού |
447.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.716 |
| Σημείο ανάφλεξης |
254.9°C |
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
