Ονομασία του προϊόντος |
2,4-Dichlorophenethylamine |
Συνώνυμα |
2-(2,4-Dichlorophenyl)-ethylamine; 2-(2,4-dichlorophenyl)ethanamine; 2-(2,4-dichlorophenyl)ethanaminium; 2,4-Dichloro-benzeneethanamine |
MF |
C8H9Cl2N |
Μοριακό βάρος |
190.0698 |
InChI |
InChI=1/C8H9Cl2N/c1-5(11)7-3-2-6(9)4-8(7)10/h2-5H,11H2,1H3 |
CAS ΟΧΙ |
52516-13-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.262g/cm3 |
Σημείο βρασμού |
256.4°C at 760 mmHg |
Δείκτης διάθλασης |
1.566 |
Σημείο ανάφλεξης |
108.8°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|