Ονομασία του προϊόντος |
N-Methyl-2-nitroaniline |
Συνώνυμα |
Benzenamine, N-methyl-2-nitro-; 2-Nitro-N-methylaniline; 4-12-00-01564 (Beilstein Handbook Reference); Aniline, N-methyl-o-nitro-; BRN 2209110; N-Methyl-2-nitrobenzenamine; N-Methyl-o-nitroaniline; NSC 86672; o-(Methylamino)nitrobenzene; o-Nitro-N-methylaniline |
MF |
C7H8N2O2 |
Μοριακό βάρος |
152.1506 |
InChI |
InChI=1/C7H8N2O2/c1-8-6-4-2-3-5-7(6)9(10)11/h2-5,8H,1H3 |
CAS ΟΧΙ |
612-28-2 |
EINECS |
210-303-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.26g/cm3 |
Σημείο τήξης |
33-37℃ |
Σημείο βρασμού |
277.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.619 |
Σημείο ανάφλεξης |
121.9°C |
Σύμβολα επικινδυνότητας |
T:Toxic;
|
Κινδύνου Κώδικες |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
Περιγραφή της ασφάλειας |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|